C17H16F3NOS — CID 112777132
2-benzhydrylsulfanyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 112777132) has the molecular formula C17H16F3NOS and a molecular weight of 339.38 g/mol. Its IUPAC name is 2-benzhydrylsulfanyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-benzhydrylsulfanyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 112777132 |
| Molecular Formula | C17H16F3NOS |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-benzhydrylsulfanyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CSC(c1ccccc1)c1ccccc1)NCC(F)(F)F |
| InChI | InChI=1S/C17H16F3NOS/c18-17(19,20)12-21-15(22)11-23-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,16H,11-12H2,(H,21,22) |
| InChIKey | HSYQPEUNOGDVNG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |