C11H12F3NOS — CID 78786041
3-phenylsulfanyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 78786041) has the molecular formula C11H12F3NOS and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-phenylsulfanyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 3-phenylsulfanyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 78786041 |
| Molecular Formula | C11H12F3NOS |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-phenylsulfanyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | O=C(CCSc1ccccc1)NCC(F)(F)F |
| InChI | InChI=1S/C11H12F3NOS/c12-11(13,14)8-15-10(16)6-7-17-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,15,16) |
| InChIKey | SHPFVESSGDWNJK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |