C17H18OS2 — CID 14244732
1,5-bis(phenylsulfanyl)pentan-3-one (PubChem CID 14244732) has the molecular formula C17H18OS2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1,5-bis(phenylsulfanyl)pentan-3-one.
| Compound Name | 1,5-bis(phenylsulfanyl)pentan-3-one |
|---|---|
| PubChem CID | 14244732 |
| Molecular Formula | C17H18OS2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1,5-bis(phenylsulfanyl)pentan-3-one |
| SMILES | O=C(CCSc1ccccc1)CCSc1ccccc1 |
| InChI | InChI=1S/C17H18OS2/c18-15(11-13-19-16-7-3-1-4-8-16)12-14-20-17-9-5-2-6-10-17/h1-10H,11-14H2 |
| InChIKey | YJXKZYFWVKKSNN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |