About 2-phenylsulfanylethyl hydrogen carbonate
2-phenylsulfanylethyl hydrogen carbonate (PubChem CID 54537895) has the molecular formula C9H10O3S
and a molecular weight of 198.24 g/mol. Its IUPAC name is 2-phenylsulfanylethyl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-phenylsulfanylethyl hydrogen carbonate |
| PubChem CID | 54537895 |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 2-phenylsulfanylethyl hydrogen carbonate |
| SMILES | O=C(O)OCCSc1ccccc1 |
| InChI | InChI=1S/C9H10O3S/c10-9(11)12-6-7-13-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11) |
| InChIKey | HSDJEKLMEQCRNM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylsulfanylethyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylethyl hydrogen carbonate?
The IUPAC name of 2-phenylsulfanylethyl hydrogen carbonate (CID 54537895) is 2-phenylsulfanylethyl hydrogen carbonate.
What is the SMILES notation for 2-phenylsulfanylethyl hydrogen carbonate?
The canonical SMILES for 2-phenylsulfanylethyl hydrogen carbonate is O=C(O)OCCSc1ccccc1.
What is the InChIKey of 2-phenylsulfanylethyl hydrogen carbonate?
The InChIKey is HSDJEKLMEQCRNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3S/c10-9(11)12-6-7-13-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11).
What are the key properties of 2-phenylsulfanylethyl hydrogen carbonate?
2-phenylsulfanylethyl hydrogen carbonate has a molecular weight of 198.24 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylethyl hydrogen carbonate is sourced from PubChem (CID 54537895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).