About 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate
2-phenylsulfanylethyl 2-amino-5-chlorobenzoate (PubChem CID 79227643) has the molecular formula C15H14ClNO2S
and a molecular weight of 307.80 g/mol. Its IUPAC name is 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate.
Molecular Properties
| Compound Name | 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate |
| PubChem CID | 79227643 |
| Molecular Formula | C15H14ClNO2S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate |
| SMILES | Nc1ccc(Cl)cc1C(=O)OCCSc1ccccc1 |
| InChI | InChI=1S/C15H14ClNO2S/c16-11-6-7-14(17)13(10-11)15(18)19-8-9-20-12-4-2-1-3-5-12/h1-7,10H,8-9,17H2 |
| InChIKey | CORZMSMZNRUWOS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate?
The IUPAC name of 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate (CID 79227643) is 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate.
What is the SMILES notation for 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate?
The canonical SMILES for 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate is Nc1ccc(Cl)cc1C(=O)OCCSc1ccccc1.
What is the InChIKey of 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate?
The InChIKey is CORZMSMZNRUWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO2S/c16-11-6-7-14(17)13(10-11)15(18)19-8-9-20-12-4-2-1-3-5-12/h1-7,10H,8-9,17H2.
What are the key properties of 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate?
2-phenylsulfanylethyl 2-amino-5-chlorobenzoate has a molecular weight of 307.80 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylethyl 2-amino-5-chlorobenzoate is sourced from PubChem (CID 79227643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).