C18H19ClN2O3 — CID 7472403
[2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-amino-5-chlorobenzoate (PubChem CID 7472403) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-amino-5-chlorobenzoate.
| Compound Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-amino-5-chlorobenzoate |
|---|---|
| PubChem CID | 7472403 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2-amino-5-chlorobenzoate |
| SMILES | CC(C)N(C(=O)COC(=O)c1cc(Cl)ccc1N)c1ccccc1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-12(2)21(14-6-4-3-5-7-14)17(22)11-24-18(23)15-10-13(19)8-9-16(15)20/h3-10,12H,11,20H2,1-2H3 |
| InChIKey | BCFTTXMOIXGWDF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|