C18H17Cl2NO3 — CID 55314052
[2-oxo-2-(N-propan-2-ylanilino)ethyl] 2,6-dichlorobenzoate (PubChem CID 55314052) has the molecular formula C18H17Cl2NO3 and a molecular weight of 366.24 g/mol. Its IUPAC name is [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 55314052 |
| Molecular Formula | C18H17Cl2NO3 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 2,6-dichlorobenzoate |
| SMILES | CC(C)N(C(=O)COC(=O)c1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H17Cl2NO3/c1-12(2)21(13-7-4-3-5-8-13)16(22)11-24-18(23)17-14(19)9-6-10-15(17)20/h3-10,12H,11H2,1-2H3 |
| InChIKey | QMBCZWMATGWTIV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |