About [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate
[2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate (PubChem CID 2397528) has the molecular formula C16H19N3O4
and a molecular weight of 317.35 g/mol. Its IUPAC name is [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate |
| PubChem CID | 2397528 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate |
| SMILES | CC(C)N(C(=O)COC(=O)C1=CCC(=O)NN1)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O4/c1-11(2)19(12-6-4-3-5-7-12)15(21)10-23-16(22)13-8-9-14(20)18-17-13/h3-8,11,17H,9-10H2,1-2H3,(H,18,20) |
| InChIKey | OGTHLWNGOMQYOX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate?
The IUPAC name of [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate (CID 2397528) is [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate.
What is the SMILES notation for [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate?
The canonical SMILES for [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate is CC(C)N(C(=O)COC(=O)C1=CCC(=O)NN1)c1ccccc1.
What is the InChIKey of [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate?
The InChIKey is OGTHLWNGOMQYOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4/c1-11(2)19(12-6-4-3-5-7-12)15(21)10-23-16(22)13-8-9-14(20)18-17-13/h3-8,11,17H,9-10H2,1-2H3,(H,18,20).
What are the key properties of [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate?
[2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate has a molecular weight of 317.35 g/mol, XLogP of 0.88, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(N-propan-2-ylanilino)ethyl] 3-oxo-2,4-dihydro-1H-pyridazine-6-carboxylate is sourced from PubChem (CID 2397528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).