About hexyl 2-amino-5-chlorobenzoate
hexyl 2-amino-5-chlorobenzoate (PubChem CID 63447328) has the molecular formula C13H18ClNO2
and a molecular weight of 255.75 g/mol. Its IUPAC name is hexyl 2-amino-5-chlorobenzoate.
Molecular Properties
| Compound Name | hexyl 2-amino-5-chlorobenzoate |
| PubChem CID | 63447328 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | hexyl 2-amino-5-chlorobenzoate |
| SMILES | CCCCCCOC(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C13H18ClNO2/c1-2-3-4-5-8-17-13(16)11-9-10(14)6-7-12(11)15/h6-7,9H,2-5,8,15H2,1H3 |
| InChIKey | VEPWYANMKWQJFS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze hexyl 2-amino-5-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 2-amino-5-chlorobenzoate?
The IUPAC name of hexyl 2-amino-5-chlorobenzoate (CID 63447328) is hexyl 2-amino-5-chlorobenzoate.
What is the SMILES notation for hexyl 2-amino-5-chlorobenzoate?
The canonical SMILES for hexyl 2-amino-5-chlorobenzoate is CCCCCCOC(=O)c1cc(Cl)ccc1N.
What is the InChIKey of hexyl 2-amino-5-chlorobenzoate?
The InChIKey is VEPWYANMKWQJFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO2/c1-2-3-4-5-8-17-13(16)11-9-10(14)6-7-12(11)15/h6-7,9H,2-5,8,15H2,1H3.
What are the key properties of hexyl 2-amino-5-chlorobenzoate?
hexyl 2-amino-5-chlorobenzoate has a molecular weight of 255.75 g/mol, XLogP of 3.66, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 2-amino-5-chlorobenzoate is sourced from PubChem (CID 63447328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).