About butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate
butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate (PubChem CID 101384340) has the molecular formula C23H30N2O4
and a molecular weight of 398.50 g/mol. Its IUPAC name is butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate.
Molecular Properties
| Compound Name | butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate |
| PubChem CID | 101384340 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate |
| SMILES | CCCCOC(=O)c1cc(Cc2ccc(N)c(C(=O)OCCCC)c2)ccc1N |
| InChI | InChI=1S/C23H30N2O4/c1-3-5-11-28-22(26)18-14-16(7-9-20(18)24)13-17-8-10-21(25)19(15-17)23(27)29-12-6-4-2/h7-10,14-15H,3-6,11-13,24-25H2,1-2H3 |
| InChIKey | RUSANTHHRDTXAD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate?
The IUPAC name of butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate (CID 101384340) is butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate.
What is the SMILES notation for butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate?
The canonical SMILES for butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate is CCCCOC(=O)c1cc(Cc2ccc(N)c(C(=O)OCCCC)c2)ccc1N.
What is the InChIKey of butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate?
The InChIKey is RUSANTHHRDTXAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O4/c1-3-5-11-28-22(26)18-14-16(7-9-20(18)24)13-17-8-10-21(25)19(15-17)23(27)29-12-6-4-2/h7-10,14-15H,3-6,11-13,24-25H2,1-2H3.
What are the key properties of butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate?
butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate has a molecular weight of 398.50 g/mol, XLogP of 4.36, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-amino-5-[(4-amino-3-butoxycarbonylphenyl)methyl]benzoate is sourced from PubChem (CID 101384340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).