C12H10F6O3S — CID 162509142
2-phenylsulfanylethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate (PubChem CID 162509142) has the molecular formula C12H10F6O3S and a molecular weight of 348.26 g/mol. Its IUPAC name is 2-phenylsulfanylethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate.
| Compound Name | 2-phenylsulfanylethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 162509142 |
| Molecular Formula | C12H10F6O3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-phenylsulfanylethyl 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoate |
| SMILES | O=C(OCCSc1ccccc1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F6O3S/c13-11(14,15)10(20,12(16,17)18)9(19)21-6-7-22-8-4-2-1-3-5-8/h1-5,20H,6-7H2 |
| InChIKey | KVBLFBCZNDFDNS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|