C14H9F9O5 — CID 166910194
2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 4-(trifluoromethyl)benzoate (PubChem CID 166910194) has the molecular formula C14H9F9O5 and a molecular weight of 428.20 g/mol. Its IUPAC name is 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 4-(trifluoromethyl)benzoate.
| Compound Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 166910194 |
| Molecular Formula | C14H9F9O5 |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 4-(trifluoromethyl)benzoate |
| SMILES | O=C(OCCOC(=O)C(O)(C(F)(F)F)C(F)(F)F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H9F9O5/c15-12(16,17)8-3-1-7(2-4-8)9(24)27-5-6-28-10(25)11(26,13(18,19)20)14(21,22)23/h1-4,26H,5-6H2 |
| InChIKey | KABOFYFROUUCEQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|