About 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate
4-hydrazinylbutyl 4-(trifluoromethyl)benzoate (PubChem CID 176908832) has the molecular formula C12H15F3N2O2
and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate |
| PubChem CID | 176908832 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate |
| SMILES | NNCCCCOC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3N2O2/c13-12(14,15)10-5-3-9(4-6-10)11(18)19-8-2-1-7-17-16/h3-6,17H,1-2,7-8,16H2 |
| InChIKey | HDDZCIOAFKFKBR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate?
The IUPAC name of 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate (CID 176908832) is 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate.
What is the SMILES notation for 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate?
The canonical SMILES for 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate is NNCCCCOC(=O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate?
The InChIKey is HDDZCIOAFKFKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O2/c13-12(14,15)10-5-3-9(4-6-10)11(18)19-8-2-1-7-17-16/h3-6,17H,1-2,7-8,16H2.
What are the key properties of 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate?
4-hydrazinylbutyl 4-(trifluoromethyl)benzoate has a molecular weight of 276.26 g/mol, XLogP of 2.11, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydrazinylbutyl 4-(trifluoromethyl)benzoate is sourced from PubChem (CID 176908832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).