C27H31F3O4 — CID 162393415
ethyl 4-[(E)-10-[4-(trifluoromethyl)benzoyl]oxydec-2-enyl]benzoate (PubChem CID 162393415) has the molecular formula C27H31F3O4 and a molecular weight of 476.54 g/mol. Its IUPAC name is ethyl 4-[(E)-10-[4-(trifluoromethyl)benzoyl]oxydec-2-enyl]benzoate.
| Compound Name | ethyl 4-[(E)-10-[4-(trifluoromethyl)benzoyl]oxydec-2-enyl]benzoate |
|---|---|
| PubChem CID | 162393415 |
| Molecular Formula | C27H31F3O4 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | ethyl 4-[(E)-10-[4-(trifluoromethyl)benzoyl]oxydec-2-enyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C/C=C/CCCCCCCOC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H31F3O4/c1-2-33-25(31)22-14-12-21(13-15-22)11-9-7-5-3-4-6-8-10-20-34-26(32)23-16-18-24(19-17-23)27(28,29)30/h7,9,12-19H,2-6,8,10-11,20H2,1H3/b9-7+ |
| InChIKey | GUYGILYBNLQKNM-VQHVLOKHSA-N |
| XLogP | 7.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|