C30H34O4 — CID 162393403
[(E)-10-(4-ethoxycarbonylphenyl)dec-8-enyl] naphthalene-1-carboxylate (PubChem CID 162393403) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is [(E)-10-(4-ethoxycarbonylphenyl)dec-8-enyl] naphthalene-1-carboxylate.
| Compound Name | [(E)-10-(4-ethoxycarbonylphenyl)dec-8-enyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 162393403 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | [(E)-10-(4-ethoxycarbonylphenyl)dec-8-enyl] naphthalene-1-carboxylate |
| SMILES | CCOC(=O)c1ccc(C/C=C/CCCCCCCOC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C30H34O4/c1-2-33-29(31)26-21-19-24(20-22-26)14-9-7-5-3-4-6-8-12-23-34-30(32)28-18-13-16-25-15-10-11-17-27(25)28/h7,9-11,13,15-22H,2-6,8,12,14,23H2,1H3/b9-7+ |
| InChIKey | MQQLBHSUQFIMBF-VQHVLOKHSA-N |
| XLogP | 7.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|