C27H42O4 — CID 66690884
2-nonadec-9-enoxycarbonylbenzoic acid (PubChem CID 66690884) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is 2-nonadec-9-enoxycarbonylbenzoic acid.
| Compound Name | 2-nonadec-9-enoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 66690884 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | 2-nonadec-9-enoxycarbonylbenzoic acid |
| SMILES | CCCCCCCCCC=CCCCCCCCCOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C27H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-23-31-27(30)25-22-19-18-21-24(25)26(28)29/h10-11,18-19,21-22H,2-9,12-17,20,23H2,1H3,(H,28,29) |
| InChIKey | BBRAPUWDSKMINB-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|