C28H43NO5 — CID 6365839
2-[2-[[(E)-octadec-9-enoyl]amino]ethoxycarbonyl]benzoic acid (PubChem CID 6365839) has the molecular formula C28H43NO5 and a molecular weight of 473.65 g/mol. Its IUPAC name is 2-[2-[[(E)-octadec-9-enoyl]amino]ethoxycarbonyl]benzoic acid.
| Compound Name | 2-[2-[[(E)-octadec-9-enoyl]amino]ethoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 6365839 |
| Molecular Formula | C28H43NO5 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | 2-[2-[[(E)-octadec-9-enoyl]amino]ethoxycarbonyl]benzoic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)NCCOC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C28H43NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-26(30)29-22-23-34-28(33)25-20-18-17-19-24(25)27(31)32/h9-10,17-20H,2-8,11-16,21-23H2,1H3,(H,29,30)(H,31,32)/b10-9+ |
| InChIKey | XZSQNMZQGKVKGD-MDZDMXLPSA-N |
| XLogP | 6.70 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|