C28H42NNaO5 — CID 53437977
sodium 2-[2-(octadec-9-enoylamino)ethoxycarbonyl]benzoate (PubChem CID 53437977) has the molecular formula C28H42NNaO5 and a molecular weight of 495.64 g/mol. Its IUPAC name is sodium 2-[2-(octadec-9-enoylamino)ethoxycarbonyl]benzoate.
| Compound Name | sodium 2-[2-(octadec-9-enoylamino)ethoxycarbonyl]benzoate |
|---|---|
| PubChem CID | 53437977 |
| Molecular Formula | C28H42NNaO5 |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | sodium 2-[2-(octadec-9-enoylamino)ethoxycarbonyl]benzoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCOC(=O)c1ccccc1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C28H43NO5.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-26(30)29-22-23-34-28(33)25-20-18-17-19-24(25)27(31)32;/h9-10,17-20H,2-8,11-16,21-23H2,1H3,(H,29,30)(H,31,32);/q;+1/p-1 |
| InChIKey | PHDOFDUDTZUIMM-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|