C30H48BaO6 — CID 161405837
barium(2+);2-butoxycarbonylbenzoate;octadecanoate (PubChem CID 161405837) has the molecular formula C30H48BaO6 and a molecular weight of 642.04 g/mol. Its IUPAC name is barium(2+);2-butoxycarbonylbenzoate;octadecanoate.
| Compound Name | barium(2+);2-butoxycarbonylbenzoate;octadecanoate |
|---|---|
| PubChem CID | 161405837 |
| Molecular Formula | C30H48BaO6 |
| Molecular Weight | 642.04 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | barium(2+);2-butoxycarbonylbenzoate;octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].CCCCOC(=O)c1ccccc1C(=O)[O-].[Ba+2] |
| InChI | InChI=1S/C18H36O2.C12H14O4.Ba/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-8-16-12(15)10-7-5-4-6-9(10)11(13)14;/h2-17H2,1H3,(H,19,20);4-7H,2-3,8H2,1H3,(H,13,14);/q;;+2/p-2 |
| InChIKey | VUVBNVSOPHSQRV-UHFFFAOYSA-L |
| XLogP | 5.62 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.04 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|