C27H34O4 — CID 162393423
[(E)-10-(4-ethoxycarbonylphenyl)dec-8-enyl] 2-methylbenzoate (PubChem CID 162393423) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is [(E)-10-(4-ethoxycarbonylphenyl)dec-8-enyl] 2-methylbenzoate.
| Compound Name | [(E)-10-(4-ethoxycarbonylphenyl)dec-8-enyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 162393423 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | [(E)-10-(4-ethoxycarbonylphenyl)dec-8-enyl] 2-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C/C=C/CCCCCCCOC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C27H34O4/c1-3-30-26(28)24-19-17-23(18-20-24)15-10-8-6-4-5-7-9-13-21-31-27(29)25-16-12-11-14-22(25)2/h8,10-12,14,16-20H,3-7,9,13,15,21H2,1-2H3/b10-8+ |
| InChIKey | DFKXIBMSIIORAK-CSKARUKUSA-N |
| XLogP | 6.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|