C18H12BrF6NaO7S — CID 160757102
sodium;bromomethyl 4-(trifluoromethyl)benzoate;[4-(trifluoromethyl)benzoyl]oxymethanesulfonate (PubChem CID 160757102) has the molecular formula C18H12BrF6NaO7S and a molecular weight of 589.24 g/mol. Its IUPAC name is sodium;bromomethyl 4-(trifluoromethyl)benzoate;[4-(trifluoromethyl)benzoyl]oxymethanesulfonate.
| Compound Name | sodium;bromomethyl 4-(trifluoromethyl)benzoate;[4-(trifluoromethyl)benzoyl]oxymethanesulfonate |
|---|---|
| PubChem CID | 160757102 |
| Molecular Formula | C18H12BrF6NaO7S |
| Molecular Weight | 589.24 g/mol |
| Exact Mass | 587.93 |
| IUPAC Name | sodium;bromomethyl 4-(trifluoromethyl)benzoate;[4-(trifluoromethyl)benzoyl]oxymethanesulfonate |
| SMILES | O=C(OCBr)c1ccc(C(F)(F)F)cc1.O=C(OCS(=O)(=O)[O-])c1ccc(C(F)(F)F)cc1.[Na+] |
| InChI | InChI=1S/C9H6BrF3O2.C9H7F3O5S.Na/c10-5-15-8(14)6-1-3-7(4-2-6)9(11,12)13;10-9(11,12)7-3-1-6(2-4-7)8(13)17-5-18(14,15)16;/h1-4H,5H2;1-4H,5H2,(H,14,15,16);/q;;+1/p-1 |
| InChIKey | RXOQDMYUOACYAX-UHFFFAOYSA-M |
| XLogP | 1.58 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|