C12H10F3N5O2 — CID 9415138
(4,6-diamino-1,3,5-triazin-2-yl)methyl 4-(trifluoromethyl)benzoate (PubChem CID 9415138) has the molecular formula C12H10F3N5O2 and a molecular weight of 313.24 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl 4-(trifluoromethyl)benzoate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 9415138 |
| Molecular Formula | C12H10F3N5O2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 4-(trifluoromethyl)benzoate |
| SMILES | Nc1nc(N)nc(COC(=O)c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C12H10F3N5O2/c13-12(14,15)7-3-1-6(2-4-7)9(21)22-5-8-18-10(16)20-11(17)19-8/h1-4H,5H2,(H4,16,17,18,19,20) |
| InChIKey | UESBBCWHSYOUBX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |