About 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate
2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate (PubChem CID 162536715) has the molecular formula C12H11F3O3
and a molecular weight of 260.21 g/mol. Its IUPAC name is 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate |
| PubChem CID | 162536715 |
| Molecular Formula | C12H11F3O3 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate |
| SMILES | C=CC(O)COC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3O3/c1-2-10(16)7-18-11(17)8-3-5-9(6-4-8)12(13,14)15/h2-6,10,16H,1,7H2 |
| InChIKey | CKVOWOYOFHKQDA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate?
The IUPAC name of 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate (CID 162536715) is 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate.
What is the SMILES notation for 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate?
The canonical SMILES for 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate is C=CC(O)COC(=O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate?
The InChIKey is CKVOWOYOFHKQDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3O3/c1-2-10(16)7-18-11(17)8-3-5-9(6-4-8)12(13,14)15/h2-6,10,16H,1,7H2.
What are the key properties of 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate?
2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate has a molecular weight of 260.21 g/mol, XLogP of 2.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybut-3-enyl 4-(trifluoromethyl)benzoate is sourced from PubChem (CID 162536715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).