C14H13F3O3 — CID 156628403
4-[4-(trifluoromethyl)benzoyl]hex-5-enoic acid (PubChem CID 156628403) has the molecular formula C14H13F3O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)benzoyl]hex-5-enoic acid.
| Compound Name | 4-[4-(trifluoromethyl)benzoyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 156628403 |
| Molecular Formula | C14H13F3O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-[4-(trifluoromethyl)benzoyl]hex-5-enoic acid |
| SMILES | C=CC(CCC(=O)O)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3O3/c1-2-9(5-8-12(18)19)13(20)10-3-6-11(7-4-10)14(15,16)17/h2-4,6-7,9H,1,5,8H2,(H,18,19) |
| InChIKey | SVRBVXXMNKUFHB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|