C15H17F3O3 — CID 134279069
4-[2-methyl-4-(trifluoromethyl)phenyl]-5-oxoheptanoic acid (PubChem CID 134279069) has the molecular formula C15H17F3O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 4-[2-methyl-4-(trifluoromethyl)phenyl]-5-oxoheptanoic acid.
| Compound Name | 4-[2-methyl-4-(trifluoromethyl)phenyl]-5-oxoheptanoic acid |
|---|---|
| PubChem CID | 134279069 |
| Molecular Formula | C15H17F3O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 4-[2-methyl-4-(trifluoromethyl)phenyl]-5-oxoheptanoic acid |
| SMILES | CCC(=O)C(CCC(=O)O)c1ccc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C15H17F3O3/c1-3-13(19)12(6-7-14(20)21)11-5-4-10(8-9(11)2)15(16,17)18/h4-5,8,12H,3,6-7H2,1-2H3,(H,20,21) |
| InChIKey | AHPHHEOAASNSJT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |