C12H14F3NO4S — CID 120782419
3-[methyl-[2-methyl-4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid (PubChem CID 120782419) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is 3-[methyl-[2-methyl-4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid.
| Compound Name | 3-[methyl-[2-methyl-4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 120782419 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-[methyl-[2-methyl-4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid |
| SMILES | Cc1cc(C(F)(F)F)ccc1S(=O)(=O)N(C)CCC(=O)O |
| InChI | InChI=1S/C12H14F3NO4S/c1-8-7-9(12(13,14)15)3-4-10(8)21(19,20)16(2)6-5-11(17)18/h3-4,7H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | FONKOJVIOCHEPN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |