C12H14F3NO4S — CID 61007490
3-[ethyl-[4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid (PubChem CID 61007490) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is 3-[ethyl-[4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid.
| Compound Name | 3-[ethyl-[4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 61007490 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-[ethyl-[4-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO4S/c1-2-16(8-7-11(17)18)21(19,20)10-5-3-9(4-6-10)12(13,14)15/h3-6H,2,7-8H2,1H3,(H,17,18) |
| InChIKey | RHQPGMFSONOQDS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |