C17H27NO4S — CID 84557829
3-[ethyl-(4-hexylphenyl)sulfonylamino]propanoic acid (PubChem CID 84557829) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is 3-[ethyl-(4-hexylphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[ethyl-(4-hexylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 84557829 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-[ethyl-(4-hexylphenyl)sulfonylamino]propanoic acid |
| SMILES | CCCCCCc1ccc(S(=O)(=O)N(CC)CCC(=O)O)cc1 |
| InChI | InChI=1S/C17H27NO4S/c1-3-5-6-7-8-15-9-11-16(12-10-15)23(21,22)18(4-2)14-13-17(19)20/h9-12H,3-8,13-14H2,1-2H3,(H,19,20) |
| InChIKey | NAUQNWPDJJPORS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|