C21H36N2O3S — CID 55436116
3-[4-(diethylsulfamoyl)phenyl]-N-octan-2-ylpropanamide (PubChem CID 55436116) has the molecular formula C21H36N2O3S and a molecular weight of 396.60 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-octan-2-ylpropanamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-octan-2-ylpropanamide |
|---|---|
| PubChem CID | 55436116 |
| Molecular Formula | C21H36N2O3S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-octan-2-ylpropanamide |
| SMILES | CCCCCCC(C)NC(=O)CCc1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C21H36N2O3S/c1-5-8-9-10-11-18(4)22-21(24)17-14-19-12-15-20(16-13-19)27(25,26)23(6-2)7-3/h12-13,15-16,18H,5-11,14,17H2,1-4H3,(H,22,24) |
| InChIKey | FCKAZILOFGFYID-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|