C20H36N2O2S — CID 162429714
4-(8-aminooctyl)-N,N-dipropylbenzenesulfonamide (PubChem CID 162429714) has the molecular formula C20H36N2O2S and a molecular weight of 368.59 g/mol. Its IUPAC name is 4-(8-aminooctyl)-N,N-dipropylbenzenesulfonamide.
| Compound Name | 4-(8-aminooctyl)-N,N-dipropylbenzenesulfonamide |
|---|---|
| PubChem CID | 162429714 |
| Molecular Formula | C20H36N2O2S |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 4-(8-aminooctyl)-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(CCCCCCCCN)cc1 |
| InChI | InChI=1S/C20H36N2O2S/c1-3-17-22(18-4-2)25(23,24)20-14-12-19(13-15-20)11-9-7-5-6-8-10-16-21/h12-15H,3-11,16-18,21H2,1-2H3 |
| InChIKey | WAJASAXLEYELED-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|