C11H14BrNO4S — CID 61009872
3-[(3-bromophenyl)sulfonyl-ethylamino]propanoic acid (PubChem CID 61009872) has the molecular formula C11H14BrNO4S and a molecular weight of 336.21 g/mol. Its IUPAC name is 3-[(3-bromophenyl)sulfonyl-ethylamino]propanoic acid.
| Compound Name | 3-[(3-bromophenyl)sulfonyl-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 61009872 |
| Molecular Formula | C11H14BrNO4S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 3-[(3-bromophenyl)sulfonyl-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)S(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H14BrNO4S/c1-2-13(7-6-11(14)15)18(16,17)10-5-3-4-9(12)8-10/h3-5,8H,2,6-7H2,1H3,(H,14,15) |
| InChIKey | DAUHRCBKUMFRHU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |