C11H13BrClNO4S — CID 61009612
3-[(4-bromo-2-chlorophenyl)sulfonyl-ethylamino]propanoic acid (PubChem CID 61009612) has the molecular formula C11H13BrClNO4S and a molecular weight of 370.65 g/mol. Its IUPAC name is 3-[(4-bromo-2-chlorophenyl)sulfonyl-ethylamino]propanoic acid.
| Compound Name | 3-[(4-bromo-2-chlorophenyl)sulfonyl-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 61009612 |
| Molecular Formula | C11H13BrClNO4S |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | 3-[(4-bromo-2-chlorophenyl)sulfonyl-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)S(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C11H13BrClNO4S/c1-2-14(6-5-11(15)16)19(17,18)10-4-3-8(12)7-9(10)13/h3-4,7H,2,5-6H2,1H3,(H,15,16) |
| InChIKey | JXROZITVMYYCIW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |