C10H12BrClN2O3S — CID 40753294
2-[(4-bromo-2-chlorophenyl)sulfonylamino]-N,N-dimethylacetamide (PubChem CID 40753294) has the molecular formula C10H12BrClN2O3S and a molecular weight of 355.64 g/mol. Its IUPAC name is 2-[(4-bromo-2-chlorophenyl)sulfonylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(4-bromo-2-chlorophenyl)sulfonylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 40753294 |
| Molecular Formula | C10H12BrClN2O3S |
| Molecular Weight | 355.64 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 2-[(4-bromo-2-chlorophenyl)sulfonylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNS(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C10H12BrClN2O3S/c1-14(2)10(15)6-13-18(16,17)9-4-3-7(11)5-8(9)12/h3-5,13H,6H2,1-2H3 |
| InChIKey | HDAHPOZWOXHUNW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.64 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |