C11H13BrClNO5S — CID 103153584
4-[(4-bromo-2-chlorophenyl)sulfonylamino]-3-methoxybutanoic acid (PubChem CID 103153584) has the molecular formula C11H13BrClNO5S and a molecular weight of 386.65 g/mol. Its IUPAC name is 4-[(4-bromo-2-chlorophenyl)sulfonylamino]-3-methoxybutanoic acid.
| Compound Name | 4-[(4-bromo-2-chlorophenyl)sulfonylamino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103153584 |
| Molecular Formula | C11H13BrClNO5S |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 384.94 |
| IUPAC Name | 4-[(4-bromo-2-chlorophenyl)sulfonylamino]-3-methoxybutanoic acid |
| SMILES | COC(CNS(=O)(=O)c1ccc(Br)cc1Cl)CC(=O)O |
| InChI | InChI=1S/C11H13BrClNO5S/c1-19-8(5-11(15)16)6-14-20(17,18)10-3-2-7(12)4-9(10)13/h2-4,8,14H,5-6H2,1H3,(H,15,16) |
| InChIKey | HYISYRJXARMLOW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |