C10H11BrClNO5S — CID 43405405
methyl 2-[(4-bromo-2-chlorophenyl)sulfonylamino]-3-hydroxypropanoate (PubChem CID 43405405) has the molecular formula C10H11BrClNO5S and a molecular weight of 372.62 g/mol. Its IUPAC name is methyl 2-[(4-bromo-2-chlorophenyl)sulfonylamino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(4-bromo-2-chlorophenyl)sulfonylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 43405405 |
| Molecular Formula | C10H11BrClNO5S |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 370.92 |
| IUPAC Name | methyl 2-[(4-bromo-2-chlorophenyl)sulfonylamino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NS(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C10H11BrClNO5S/c1-18-10(15)8(5-14)13-19(16,17)9-3-2-6(11)4-7(9)12/h2-4,8,13-14H,5H2,1H3 |
| InChIKey | RORAPAXXQCPBOG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |