C13H18BrCl2NO2S — CID 106256254
4-bromo-2-chloro-N-[2-(chloromethyl)-2-ethylbutyl]benzenesulfonamide (PubChem CID 106256254) has the molecular formula C13H18BrCl2NO2S and a molecular weight of 403.17 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-[2-(chloromethyl)-2-ethylbutyl]benzenesulfonamide.
| Compound Name | 4-bromo-2-chloro-N-[2-(chloromethyl)-2-ethylbutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106256254 |
| Molecular Formula | C13H18BrCl2NO2S |
| Molecular Weight | 403.17 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 4-bromo-2-chloro-N-[2-(chloromethyl)-2-ethylbutyl]benzenesulfonamide |
| SMILES | CCC(CC)(CCl)CNS(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H18BrCl2NO2S/c1-3-13(4-2,8-15)9-17-20(18,19)12-6-5-10(14)7-11(12)16/h5-7,17H,3-4,8-9H2,1-2H3 |
| InChIKey | MNZHZKOCZGKOCV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.17 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|