C10H11ClFNO4S — CID 54900227
2-[(2-chloro-4-fluorophenyl)sulfonyl-ethylamino]acetic acid (PubChem CID 54900227) has the molecular formula C10H11ClFNO4S and a molecular weight of 295.72 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)sulfonyl-ethylamino]acetic acid.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)sulfonyl-ethylamino]acetic acid |
|---|---|
| PubChem CID | 54900227 |
| Molecular Formula | C10H11ClFNO4S |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)sulfonyl-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)S(=O)(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C10H11ClFNO4S/c1-2-13(6-10(14)15)18(16,17)9-4-3-7(12)5-8(9)11/h3-5H,2,6H2,1H3,(H,14,15) |
| InChIKey | IXABFTUUOZXEAD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |