C12H14F3NO5S — CID 122071240
2-[[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonyl-propylamino]acetic acid (PubChem CID 122071240) has the molecular formula C12H14F3NO5S and a molecular weight of 341.31 g/mol. Its IUPAC name is 2-[[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonyl-propylamino]acetic acid.
| Compound Name | 2-[[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonyl-propylamino]acetic acid |
|---|---|
| PubChem CID | 122071240 |
| Molecular Formula | C12H14F3NO5S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonyl-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)S(=O)(=O)c1cc(C(F)(F)F)ccc1O |
| InChI | InChI=1S/C12H14F3NO5S/c1-2-5-16(7-11(18)19)22(20,21)10-6-8(12(13,14)15)3-4-9(10)17/h3-4,6,17H,2,5,7H2,1H3,(H,18,19) |
| InChIKey | AAZYUABWMAVPIH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |