C14H18F3NO4S — CID 154156894
4-(dipropylsulfamoyl)-3-(trifluoromethyl)benzoic acid (PubChem CID 154156894) has the molecular formula C14H18F3NO4S and a molecular weight of 353.36 g/mol. Its IUPAC name is 4-(dipropylsulfamoyl)-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(dipropylsulfamoyl)-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 154156894 |
| Molecular Formula | C14H18F3NO4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 4-(dipropylsulfamoyl)-3-(trifluoromethyl)benzoic acid |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO4S/c1-3-7-18(8-4-2)23(21,22)12-6-5-10(13(19)20)9-11(12)14(15,16)17/h5-6,9H,3-4,7-8H2,1-2H3,(H,19,20) |
| InChIKey | QFNDVSTYXRCAEO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |