C13H17ClF3NO2S — CID 134017324
4-chloro-N,N-dipropyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 134017324) has the molecular formula C13H17ClF3NO2S and a molecular weight of 343.80 g/mol. Its IUPAC name is 4-chloro-N,N-dipropyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N,N-dipropyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134017324 |
| Molecular Formula | C13H17ClF3NO2S |
| Molecular Weight | 343.80 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 4-chloro-N,N-dipropyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17ClF3NO2S/c1-3-7-18(8-4-2)21(19,20)10-5-6-12(14)11(9-10)13(15,16)17/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | PYJMPHYIZAEENW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |