C23H41ClN2O4S — CID 158708751
N-butylbutan-1-amine;4-chloro-3-(dibutylsulfamoyl)benzoic acid (PubChem CID 158708751) has the molecular formula C23H41ClN2O4S and a molecular weight of 477.11 g/mol. Its IUPAC name is N-butylbutan-1-amine;4-chloro-3-(dibutylsulfamoyl)benzoic acid.
| Compound Name | N-butylbutan-1-amine;4-chloro-3-(dibutylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 158708751 |
| Molecular Formula | C23H41ClN2O4S |
| Molecular Weight | 477.11 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | N-butylbutan-1-amine;4-chloro-3-(dibutylsulfamoyl)benzoic acid |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1cc(C(=O)O)ccc1Cl.CCCCNCCCC |
| InChI | InChI=1S/C15H22ClNO4S.C8H19N/c1-3-5-9-17(10-6-4-2)22(20,21)14-11-12(15(18)19)7-8-13(14)16;1-3-5-7-9-8-6-4-2/h7-8,11H,3-6,9-10H2,1-2H3,(H,18,19);9H,3-8H2,1-2H3 |
| InChIKey | IILJLHMWAXBBSU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.11 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|