C22H18F7NO6 — CID 118688985
[(2R,3R,4R,5Z)-4-fluoro-2-hydroxy-5-methoxyimino-3-[4-(trifluoromethyl)benzoyl]oxypentyl] 4-(trifluoromethyl)benzoate (PubChem CID 118688985) has the molecular formula C22H18F7NO6 and a molecular weight of 525.37 g/mol. Its IUPAC name is [(2R,3R,4R,5Z)-4-fluoro-2-hydroxy-5-methoxyimino-3-[4-(trifluoromethyl)benzoyl]oxypentyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(2R,3R,4R,5Z)-4-fluoro-2-hydroxy-5-methoxyimino-3-[4-(trifluoromethyl)benzoyl]oxypentyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 118688985 |
| Molecular Formula | C22H18F7NO6 |
| Molecular Weight | 525.37 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | [(2R,3R,4R,5Z)-4-fluoro-2-hydroxy-5-methoxyimino-3-[4-(trifluoromethyl)benzoyl]oxypentyl] 4-(trifluoromethyl)benzoate |
| SMILES | CO/N=C\[C@@H](F)[C@H](OC(=O)c1ccc(C(F)(F)F)cc1)[C@H](O)COC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H18F7NO6/c1-34-30-10-16(23)18(36-20(33)13-4-8-15(9-5-13)22(27,28)29)17(31)11-35-19(32)12-2-6-14(7-3-12)21(24,25)26/h2-10,16-18,31H,11H2,1H3/b30-10-/t16-,17-,18+/m1/s1 |
| InChIKey | VGBMHHRWQPQQDP-KLPRXCAMSA-N |
| XLogP | 4.44 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|