C22H23BrFNO5 — CID 140676104
[(2S,3S,4R,5Z)-2-bromo-4-fluoro-5-methoxyimino-3-(4-methylbenzoyl)oxypentyl] 4-methylbenzoate (PubChem CID 140676104) has the molecular formula C22H23BrFNO5 and a molecular weight of 480.33 g/mol. Its IUPAC name is [(2S,3S,4R,5Z)-2-bromo-4-fluoro-5-methoxyimino-3-(4-methylbenzoyl)oxypentyl] 4-methylbenzoate.
| Compound Name | [(2S,3S,4R,5Z)-2-bromo-4-fluoro-5-methoxyimino-3-(4-methylbenzoyl)oxypentyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 140676104 |
| Molecular Formula | C22H23BrFNO5 |
| Molecular Weight | 480.33 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | [(2S,3S,4R,5Z)-2-bromo-4-fluoro-5-methoxyimino-3-(4-methylbenzoyl)oxypentyl] 4-methylbenzoate |
| SMILES | CO/N=C\[C@@H](F)[C@H](OC(=O)c1ccc(C)cc1)[C@@H](Br)COC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H23BrFNO5/c1-14-4-8-16(9-5-14)21(26)29-13-18(23)20(19(24)12-25-28-3)30-22(27)17-10-6-15(2)7-11-17/h4-12,18-20H,13H2,1-3H3/b25-12-/t18-,19+,20+/m0/s1 |
| InChIKey | BMRCUWBJUCNJDL-RDJURYAESA-N |
| XLogP | 4.42 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|