C30H31NO8 — CID 118337744
[(2S,3S,4S,5E)-2-hydroxy-5-methoxyimino-3,4-bis[(4-methylbenzoyl)oxy]pentyl] 4-methylbenzoate (PubChem CID 118337744) has the molecular formula C30H31NO8 and a molecular weight of 533.58 g/mol. Its IUPAC name is [(2S,3S,4S,5E)-2-hydroxy-5-methoxyimino-3,4-bis[(4-methylbenzoyl)oxy]pentyl] 4-methylbenzoate.
| Compound Name | [(2S,3S,4S,5E)-2-hydroxy-5-methoxyimino-3,4-bis[(4-methylbenzoyl)oxy]pentyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 118337744 |
| Molecular Formula | C30H31NO8 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | [(2S,3S,4S,5E)-2-hydroxy-5-methoxyimino-3,4-bis[(4-methylbenzoyl)oxy]pentyl] 4-methylbenzoate |
| SMILES | CO/N=C/[C@H](OC(=O)c1ccc(C)cc1)[C@@H](OC(=O)c1ccc(C)cc1)[C@@H](O)COC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H31NO8/c1-19-5-11-22(12-6-19)28(33)37-18-25(32)27(39-30(35)24-15-9-21(3)10-16-24)26(17-31-36-4)38-29(34)23-13-7-20(2)8-14-23/h5-17,25-27,32H,18H2,1-4H3/b31-17+/t25-,26-,27-/m0/s1 |
| InChIKey | RBGSDDXDBASFIM-ZZQUPDBFSA-N |
| XLogP | 4.21 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|