C51H38Cl3NO10S — CID 118337641
[(2S,3R,4R,5Z)-5-methoxyimino-3,4-bis[(4-phenylbenzoyl)oxy]-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-phenylbenzoate (PubChem CID 118337641) has the molecular formula C51H38Cl3NO10S and a molecular weight of 963.29 g/mol. Its IUPAC name is [(2S,3R,4R,5Z)-5-methoxyimino-3,4-bis[(4-phenylbenzoyl)oxy]-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-phenylbenzoate.
| Compound Name | [(2S,3R,4R,5Z)-5-methoxyimino-3,4-bis[(4-phenylbenzoyl)oxy]-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 118337641 |
| Molecular Formula | C51H38Cl3NO10S |
| Molecular Weight | 963.29 g/mol |
| Exact Mass | 961.13 |
| IUPAC Name | [(2S,3R,4R,5Z)-5-methoxyimino-3,4-bis[(4-phenylbenzoyl)oxy]-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-phenylbenzoate |
| SMILES | CON=C[C@@H](OC(=O)c1ccc(-c2ccccc2)cc1)[C@@H](OC(=O)c1ccc(-c2ccccc2)cc1)[C@H](COC(=O)c1ccc(-c2ccccc2)cc1)OS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C51H38Cl3NO10S/c1-61-55-31-45(63-50(57)40-25-19-37(20-26-40)34-13-7-3-8-14-34)48(64-51(58)41-27-21-38(22-28-41)35-15-9-4-10-16-35)46(65-66(59,60)47-30-43(53)42(52)29-44(47)54)32-62-49(56)39-23-17-36(18-24-39)33-11-5-2-6-12-33/h2-31,45-46,48H,32H2,1H3/t45-,46+,48-/m1/s1 |
| InChIKey | VKQRYQQSAXHDDB-GVCYEUQESA-N |
| XLogP | 11.66 |
| TPSA | 143.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.29 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|