C19H18Cl3NO5S — CID 118337662
[(2S)-5-imino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-methylbenzoate (PubChem CID 118337662) has the molecular formula C19H18Cl3NO5S and a molecular weight of 478.78 g/mol. Its IUPAC name is [(2S)-5-imino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-methylbenzoate.
| Compound Name | [(2S)-5-imino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 118337662 |
| Molecular Formula | C19H18Cl3NO5S |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | [(2S)-5-imino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-methylbenzoate |
| SMILES | [H]/N=C/CC[C@@H](COC(=O)c1ccc(C)cc1)OS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H18Cl3NO5S/c1-12-4-6-13(7-5-12)19(24)27-11-14(3-2-8-23)28-29(25,26)18-10-16(21)15(20)9-17(18)22/h4-10,14,23H,2-3,11H2,1H3/b23-8+/t14-/m0/s1 |
| InChIKey | ZEMRQTINQJBLCQ-GRLVRZOXSA-N |
| XLogP | 5.32 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|