C19H19FO6S — CID 144931051
[2-(4-fluorophenyl)sulfonyloxy-5-oxopentyl] 4-methylbenzoate (PubChem CID 144931051) has the molecular formula C19H19FO6S and a molecular weight of 394.42 g/mol. Its IUPAC name is [2-(4-fluorophenyl)sulfonyloxy-5-oxopentyl] 4-methylbenzoate.
| Compound Name | [2-(4-fluorophenyl)sulfonyloxy-5-oxopentyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 144931051 |
| Molecular Formula | C19H19FO6S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [2-(4-fluorophenyl)sulfonyloxy-5-oxopentyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(CCC=O)OS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H19FO6S/c1-14-4-6-15(7-5-14)19(22)25-13-17(3-2-12-21)26-27(23,24)18-10-8-16(20)9-11-18/h4-12,17H,2-3,13H2,1H3 |
| InChIKey | AFYACHWFPCSXLV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|