C20H20Cl3NO6S — CID 140755899
[(2S)-5-methoxyimino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-methylbenzoate (PubChem CID 140755899) has the molecular formula C20H20Cl3NO6S and a molecular weight of 508.81 g/mol. Its IUPAC name is [(2S)-5-methoxyimino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-methylbenzoate.
| Compound Name | [(2S)-5-methoxyimino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 140755899 |
| Molecular Formula | C20H20Cl3NO6S |
| Molecular Weight | 508.81 g/mol |
| Exact Mass | 507.01 |
| IUPAC Name | [(2S)-5-methoxyimino-2-(2,4,5-trichlorophenyl)sulfonyloxypentyl] 4-methylbenzoate |
| SMILES | CON=CCC[C@@H](COC(=O)c1ccc(C)cc1)OS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H20Cl3NO6S/c1-13-5-7-14(8-6-13)20(25)29-12-15(4-3-9-24-28-2)30-31(26,27)19-11-17(22)16(21)10-18(19)23/h5-11,15H,3-4,12H2,1-2H3/t15-/m0/s1 |
| InChIKey | SGUKJZRCICDWSZ-HNNXBMFYSA-N |
| XLogP | 5.30 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.81 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|