C23H26BrNO5 — CID 172985425
[(2S,3S,4R,5Z)-2-bromo-5-methoxyimino-4-methyl-3-(4-methylbenzoyl)oxypentyl] 4-methylbenzoate (PubChem CID 172985425) has the molecular formula C23H26BrNO5 and a molecular weight of 476.37 g/mol. Its IUPAC name is [(2S,3S,4R,5Z)-2-bromo-5-methoxyimino-4-methyl-3-(4-methylbenzoyl)oxypentyl] 4-methylbenzoate.
| Compound Name | [(2S,3S,4R,5Z)-2-bromo-5-methoxyimino-4-methyl-3-(4-methylbenzoyl)oxypentyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 172985425 |
| Molecular Formula | C23H26BrNO5 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | [(2S,3S,4R,5Z)-2-bromo-5-methoxyimino-4-methyl-3-(4-methylbenzoyl)oxypentyl] 4-methylbenzoate |
| SMILES | CO/N=C\[C@@H](C)[C@H](OC(=O)c1ccc(C)cc1)[C@@H](Br)COC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H26BrNO5/c1-15-5-9-18(10-6-15)22(26)29-14-20(24)21(17(3)13-25-28-4)30-23(27)19-11-7-16(2)8-12-19/h5-13,17,20-21H,14H2,1-4H3/b25-13-/t17-,20+,21+/m1/s1 |
| InChIKey | KEZAWGNSNFBKQN-MQPWDFQNSA-N |
| XLogP | 4.72 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|