C30H30BrNO7 — CID 118108943
[(2S,3S,4R,5E)-2-bromo-5-methoxyimino-3,4-bis[(4-methylbenzoyl)oxy]pentyl] 4-methylbenzoate (PubChem CID 118108943) has the molecular formula C30H30BrNO7 and a molecular weight of 596.47 g/mol. Its IUPAC name is [(2S,3S,4R,5E)-2-bromo-5-methoxyimino-3,4-bis[(4-methylbenzoyl)oxy]pentyl] 4-methylbenzoate.
| Compound Name | [(2S,3S,4R,5E)-2-bromo-5-methoxyimino-3,4-bis[(4-methylbenzoyl)oxy]pentyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 118108943 |
| Molecular Formula | C30H30BrNO7 |
| Molecular Weight | 596.47 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | [(2S,3S,4R,5E)-2-bromo-5-methoxyimino-3,4-bis[(4-methylbenzoyl)oxy]pentyl] 4-methylbenzoate |
| SMILES | CO/N=C/[C@@H](OC(=O)c1ccc(C)cc1)[C@H](OC(=O)c1ccc(C)cc1)[C@@H](Br)COC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H30BrNO7/c1-19-5-11-22(12-6-19)28(33)37-18-25(31)27(39-30(35)24-15-9-21(3)10-16-24)26(17-32-36-4)38-29(34)23-13-7-20(2)8-14-23/h5-17,25-27H,18H2,1-4H3/b32-17+/t25-,26+,27+/m0/s1 |
| InChIKey | NUNFJQACXJBDGB-ANCDCIEZSA-N |
| XLogP | 5.62 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|